About [2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate
[2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate (PubChem CID 2429881) has the molecular formula C18H21NO4
and a molecular weight of 315.37 g/mol. Its IUPAC name is [2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate.
Molecular Properties
| Compound Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate |
| PubChem CID | 2429881 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate |
| SMILES | CC(C)(C)N(Cc1ccccc1)C(=O)COC(=O)c1ccco1 |
| InChI | InChI=1S/C18H21NO4/c1-18(2,3)19(12-14-8-5-4-6-9-14)16(20)13-23-17(21)15-10-7-11-22-15/h4-11H,12-13H2,1-3H3 |
| InChIKey | KZTSQWJKKNPQQC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate?
The IUPAC name of [2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate (CID 2429881) is [2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate.
What is the SMILES notation for [2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate?
The canonical SMILES for [2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate is CC(C)(C)N(Cc1ccccc1)C(=O)COC(=O)c1ccco1.
What is the InChIKey of [2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate?
The InChIKey is KZTSQWJKKNPQQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO4/c1-18(2,3)19(12-14-8-5-4-6-9-14)16(20)13-23-17(21)15-10-7-11-22-15/h4-11H,12-13H2,1-3H3.
What are the key properties of [2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate?
[2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate has a molecular weight of 315.37 g/mol, XLogP of 3.26, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[benzyl(tert-butyl)amino]-2-oxoethyl] furan-2-carboxylate is sourced from PubChem (CID 2429881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).