About (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate
(7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 2430455) has the molecular formula C23H14BrF3N2O3
and a molecular weight of 503.27 g/mol. Its IUPAC name is (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate.
Molecular Properties
| Compound Name | (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate |
| PubChem CID | 2430455 |
| Molecular Formula | C23H14BrF3N2O3 |
| Molecular Weight | 503.27 g/mol |
| Exact Mass | 502.01 |
| IUPAC Name | (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | O=C(OCc1cc(=O)n2cc(Br)ccc2n1)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H14BrF3N2O3/c24-16-9-10-20-28-17(11-21(30)29(20)12-16)13-32-22(31)19-4-2-1-3-18(19)14-5-7-15(8-6-14)23(25,26)27/h1-12H,13H2 |
| InChIKey | DGJGFPHSDPUHNG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.27 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate?
The IUPAC name of (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate (CID 2430455) is (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate.
What is the SMILES notation for (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate?
The canonical SMILES for (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate is O=C(OCc1cc(=O)n2cc(Br)ccc2n1)c1ccccc1-c1ccc(C(F)(F)F)cc1.
What is the InChIKey of (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate?
The InChIKey is DGJGFPHSDPUHNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14BrF3N2O3/c24-16-9-10-20-28-17(11-21(30)29(20)12-16)13-32-22(31)19-4-2-1-3-18(19)14-5-7-15(8-6-14)23(25,26)27/h1-12H,13H2.
What are the key properties of (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate?
(7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate has a molecular weight of 503.27 g/mol, XLogP of 5.50, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[4-(trifluoromethyl)phenyl]benzoate is sourced from PubChem (CID 2430455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).