C29H26N2O2S2 — CID 2432748
3-(2,5-dimethylphenyl)-2-[2-(4-methylphenoxy)ethylsulfanyl]-6-phenylthieno[3,2-d]pyrimidin-4-one (PubChem CID 2432748) has the molecular formula C29H26N2O2S2 and a molecular weight of 498.67 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-2-[2-(4-methylphenoxy)ethylsulfanyl]-6-phenylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-(2,5-dimethylphenyl)-2-[2-(4-methylphenoxy)ethylsulfanyl]-6-phenylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2432748 |
| Molecular Formula | C29H26N2O2S2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-2-[2-(4-methylphenoxy)ethylsulfanyl]-6-phenylthieno[3,2-d]pyrimidin-4-one |
| SMILES | Cc1ccc(OCCSc2nc3cc(-c4ccccc4)sc3c(=O)n2-c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C29H26N2O2S2/c1-19-10-13-23(14-11-19)33-15-16-34-29-30-24-18-26(22-7-5-4-6-8-22)35-27(24)28(32)31(29)25-17-20(2)9-12-21(25)3/h4-14,17-18H,15-16H2,1-3H3 |
| InChIKey | MMLFGXLGHXDNKJ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|