C4H3N4O2+ — CID 24328
2,4-dioxo-1H-pyrimidine-5-diazonium (PubChem CID 24328) has the molecular formula C4H3N4O2+ and a molecular weight of 139.09 g/mol. Its IUPAC name is 2,4-dioxo-1H-pyrimidine-5-diazonium.
| Compound Name | 2,4-dioxo-1H-pyrimidine-5-diazonium |
|---|---|
| PubChem CID | 24328 |
| Molecular Formula | C4H3N4O2+ |
| Molecular Weight | 139.09 g/mol |
| Exact Mass | 139.03 |
| IUPAC Name | 2,4-dioxo-1H-pyrimidine-5-diazonium |
| SMILES | N#[N+]c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C4H2N4O2/c5-8-2-1-6-4(10)7-3(2)9/h1H,(H-,6,7,9,10)/p+1 |
| InChIKey | XFLJNCDBYCPPTE-UHFFFAOYSA-O |
| XLogP | -0.45 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.09 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|