C17H17N3O2 — CID 2436038
4-[2-(benzylamino)acetyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 2436038) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-[2-(benzylamino)acetyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-(benzylamino)acetyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 2436038 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 4-[2-(benzylamino)acetyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)CNCc2ccccc2)c2ccccc2N1 |
| InChI | InChI=1S/C17H17N3O2/c21-16-12-20(15-9-5-4-8-14(15)19-16)17(22)11-18-10-13-6-2-1-3-7-13/h1-9,18H,10-12H2,(H,19,21) |
| InChIKey | CGYBRQXAENMNHG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |