C20H18F3N3O3 — CID 2436780
2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 2436780) has the molecular formula C20H18F3N3O3 and a molecular weight of 405.38 g/mol. Its IUPAC name is 2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 2436780 |
| Molecular Formula | C20H18F3N3O3 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)N[C@H](CCc2ccccc2)C1=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18F3N3O3/c21-20(22,23)14-7-4-8-15(11-14)24-17(27)12-26-18(28)16(25-19(26)29)10-9-13-5-2-1-3-6-13/h1-8,11,16H,9-10,12H2,(H,24,27)(H,25,29)/t16-/m1/s1 |
| InChIKey | ODJBUDKTMWAOSC-MRXNPFEDSA-N |
| XLogP | 3.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|