C24H25F3N4O4 — CID 41114557
2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 41114557) has the molecular formula C24H25F3N4O4 and a molecular weight of 490.48 g/mol. Its IUPAC name is 2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 41114557 |
| Molecular Formula | C24H25F3N4O4 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 2-[(4R)-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)N[C@H](CCc2ccccc2)C1=O)Nc1cc(C(F)(F)F)ccc1N1CCOCC1 |
| InChI | InChI=1S/C24H25F3N4O4/c25-24(26,27)17-7-9-20(30-10-12-35-13-11-30)19(14-17)28-21(32)15-31-22(33)18(29-23(31)34)8-6-16-4-2-1-3-5-16/h1-5,7,9,14,18H,6,8,10-13,15H2,(H,28,32)(H,29,34)/t18-/m1/s1 |
| InChIKey | GLDRFFJEEXNFOP-GOSISDBHSA-N |
| XLogP | 3.03 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|