C23H23F3N4O4 — CID 41093489
2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 41093489) has the molecular formula C23H23F3N4O4 and a molecular weight of 476.46 g/mol. Its IUPAC name is 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 41093489 |
| Molecular Formula | C23H23F3N4O4 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)N[C@H](Cc2ccccc2)C1=O)Nc1cc(C(F)(F)F)ccc1N1CCOCC1 |
| InChI | InChI=1S/C23H23F3N4O4/c24-23(25,26)16-6-7-19(29-8-10-34-11-9-29)17(13-16)27-20(31)14-30-21(32)18(28-22(30)33)12-15-4-2-1-3-5-15/h1-7,13,18H,8-12,14H2,(H,27,31)(H,28,33)/t18-/m1/s1 |
| InChIKey | SDZWUZGWDLVEQY-GOSISDBHSA-N |
| XLogP | 2.64 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|