C17H15NO4 — CID 2437104
(3E)-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 2437104) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is (3E)-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3E)-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 2437104 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (3E)-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | COc1cc(/C=C2/C(=O)Nc3ccccc32)cc(OC)c1O |
| InChI | InChI=1S/C17H15NO4/c1-21-14-8-10(9-15(22-2)16(14)19)7-12-11-5-3-4-6-13(11)18-17(12)20/h3-9,19H,1-2H3,(H,18,20)/b12-7+ |
| InChIKey | YSERLISPSDGHNH-KPKJPENVSA-N |
| XLogP | 2.90 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|