C18H15N3O3 — CID 2437704
4-amino-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]isoindole-1,3-dione (PubChem CID 2437704) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 4-amino-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 4-amino-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2437704 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-amino-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]isoindole-1,3-dione |
| SMILES | Nc1cccc2c1C(=O)N(CC(=O)N1CCc3ccccc31)C2=O |
| InChI | InChI=1S/C18H15N3O3/c19-13-6-3-5-12-16(13)18(24)21(17(12)23)10-15(22)20-9-8-11-4-1-2-7-14(11)20/h1-7H,8-10,19H2 |
| InChIKey | BYTKMJVGAYJRNR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|