C23H18N2O3 — CID 113202446
2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 113202446) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 113202446 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1CCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C23H18N2O3/c26-20(24-13-11-15-5-1-2-10-19(15)24)12-14-25-22(27)17-8-3-6-16-7-4-9-18(21(16)17)23(25)28/h1-10H,11-14H2 |
| InChIKey | AWWOZFGBUCDYSI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|