C19H15BrN2O3 — CID 30429389
5-bromo-2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]isoindole-1,3-dione (PubChem CID 30429389) has the molecular formula C19H15BrN2O3 and a molecular weight of 399.24 g/mol. Its IUPAC name is 5-bromo-2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 5-bromo-2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 30429389 |
| Molecular Formula | C19H15BrN2O3 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 5-bromo-2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc(Br)cc2C(=O)N1CCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H15BrN2O3/c20-13-5-6-14-15(11-13)19(25)22(18(14)24)10-8-17(23)21-9-7-12-3-1-2-4-16(12)21/h1-6,11H,7-10H2 |
| InChIKey | LBMZJSRNJWGPIZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|