C25H20N2O3 — CID 43010471
5-(2,3-dihydroindole-1-carbonyl)-2-(2-phenylethyl)isoindole-1,3-dione (PubChem CID 43010471) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 5-(2,3-dihydroindole-1-carbonyl)-2-(2-phenylethyl)isoindole-1,3-dione.
| Compound Name | 5-(2,3-dihydroindole-1-carbonyl)-2-(2-phenylethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 43010471 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 5-(2,3-dihydroindole-1-carbonyl)-2-(2-phenylethyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(C(=O)N3CCc4ccccc43)cc2C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C25H20N2O3/c28-23(26-15-13-18-8-4-5-9-22(18)26)19-10-11-20-21(16-19)25(30)27(24(20)29)14-12-17-6-2-1-3-7-17/h1-11,16H,12-15H2 |
| InChIKey | MLLIXMRYMKZQJV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|