C26H21N3O5 — CID 42898237
[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxylate (PubChem CID 42898237) has the molecular formula C26H21N3O5 and a molecular weight of 455.47 g/mol. Its IUPAC name is [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxylate.
| Compound Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxylate |
|---|---|
| PubChem CID | 42898237 |
| Molecular Formula | C26H21N3O5 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(c1)C(=O)N(Cc1ccncc1)C2=O)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C26H21N3O5/c1-16(23(30)28-13-10-18-4-2-3-5-22(18)28)34-26(33)19-6-7-20-21(14-19)25(32)29(24(20)31)15-17-8-11-27-12-9-17/h2-9,11-12,14,16H,10,13,15H2,1H3 |
| InChIKey | KQSXZRULKQLFEA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|