C24H33N3O2 — CID 2438696
N-[(2S)-1-[4-(diethylamino)anilino]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide (PubChem CID 2438696) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[(2S)-1-[4-(diethylamino)anilino]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide.
| Compound Name | N-[(2S)-1-[4-(diethylamino)anilino]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 2438696 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-[(2S)-1-[4-(diethylamino)anilino]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide |
| SMILES | CCN(CC)c1ccc(NC(=O)[C@H](CC(C)C)NC(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C24H33N3O2/c1-6-27(7-2)20-14-12-19(13-15-20)25-24(29)22(16-17(3)4)26-23(28)21-11-9-8-10-18(21)5/h8-15,17,22H,6-7,16H2,1-5H3,(H,25,29)(H,26,28)/t22-/m0/s1 |
| InChIKey | DGXFGJWKOWYMQH-QFIPXVFZSA-N |
| XLogP | 4.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|