C23H21N3O4S2 — CID 2442696
6-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one (PubChem CID 2442696) has the molecular formula C23H21N3O4S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 6-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 2442696 |
| Molecular Formula | C23H21N3O4S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 6-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]-4H-1,4-benzoxazin-3-one |
| SMILES | C=CCn1c(SCC(=O)c2ccc3c(c2)NC(=O)CO3)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C23H21N3O4S2/c1-2-9-26-22(29)20-14-5-3-4-6-18(14)32-21(20)25-23(26)31-12-16(27)13-7-8-17-15(10-13)24-19(28)11-30-17/h2,7-8,10H,1,3-6,9,11-12H2,(H,24,28) |
| InChIKey | LGAYZIQGVMVPDT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|