C24H29N3O2S2 — CID 5123750
2-[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl]sulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 5123750) has the molecular formula C24H29N3O2S2 and a molecular weight of 455.65 g/mol. Its IUPAC name is 2-[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl]sulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl]sulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 5123750 |
| Molecular Formula | C24H29N3O2S2 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2-[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl]sulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCC(=O)c2cc(C)n(CCC)c2C)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C24H29N3O2S2/c1-5-11-26-15(3)13-18(16(26)4)19(28)14-30-24-25-22-21(23(29)27(24)12-6-2)17-9-7-8-10-20(17)31-22/h6,13H,2,5,7-12,14H2,1,3-4H3 |
| InChIKey | VIIDKRRFMOVVED-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|