C33H35N3O6S2 — CID 3332906
diethyl 5-[2,5-dimethyl-3-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate (PubChem CID 3332906) has the molecular formula C33H35N3O6S2 and a molecular weight of 633.79 g/mol. Its IUPAC name is diethyl 5-[2,5-dimethyl-3-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[2,5-dimethyl-3-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3332906 |
| Molecular Formula | C33H35N3O6S2 |
| Molecular Weight | 633.79 g/mol |
| Exact Mass | 633.20 |
| IUPAC Name | diethyl 5-[2,5-dimethyl-3-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate |
| SMILES | C=CCn1c(SCC(=O)c2cc(C)n(-c3cc(C(=O)OCC)cc(C(=O)OCC)c3)c2C)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C33H35N3O6S2/c1-6-13-35-30(38)28-24-11-9-10-12-27(24)44-29(28)34-33(35)43-18-26(37)25-14-19(4)36(20(25)5)23-16-21(31(39)41-7-2)15-22(17-23)32(40)42-8-3/h6,14-17H,1,7-13,18H2,2-5H3 |
| InChIKey | QWABKIXPLUQGSP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 109.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.79 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|