C27H26N4O4S4 — CID 53265213
ethyl 4-[[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]amino]-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylate (PubChem CID 53265213) has the molecular formula C27H26N4O4S4 and a molecular weight of 598.80 g/mol. Its IUPAC name is ethyl 4-[[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]amino]-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-[[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]amino]-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 53265213 |
| Molecular Formula | C27H26N4O4S4 |
| Molecular Weight | 598.80 g/mol |
| Exact Mass | 598.08 |
| IUPAC Name | ethyl 4-[[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]amino]-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2c(C(=O)OCC)sc(=S)n2-c2ccccc2)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C27H26N4O4S4/c1-3-14-30-24(33)20-17-12-8-9-13-18(17)38-23(20)29-26(30)37-15-19(32)28-22-21(25(34)35-4-2)39-27(36)31(22)16-10-6-5-7-11-16/h3,5-7,10-11H,1,4,8-9,12-15H2,2H3,(H,28,32) |
| InChIKey | JHVAFLCBAQVGBK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.80 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|