C26H24N4O4S4 — CID 53265039
ethyl 4-[[2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetyl]amino]-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylate (PubChem CID 53265039) has the molecular formula C26H24N4O4S4 and a molecular weight of 584.77 g/mol. Its IUPAC name is ethyl 4-[[2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetyl]amino]-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-[[2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetyl]amino]-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 53265039 |
| Molecular Formula | C26H24N4O4S4 |
| Molecular Weight | 584.77 g/mol |
| Exact Mass | 584.07 |
| IUPAC Name | ethyl 4-[[2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetyl]amino]-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2c(C(=O)OCC)sc(=S)n2-c2ccccc2)nc2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C26H24N4O4S4/c1-3-13-29-23(32)19-16-11-8-12-17(16)37-22(19)28-25(29)36-14-18(31)27-21-20(24(33)34-4-2)38-26(35)30(21)15-9-6-5-7-10-15/h3,5-7,9-10H,1,4,8,11-14H2,2H3,(H,27,31) |
| InChIKey | KYMOOHPNYBBIGP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.77 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|