C24H19N5O2S4 — CID 53265042
N-(5-cyano-3-phenyl-2-sulfanylidene-1,3-thiazol-4-yl)-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide (PubChem CID 53265042) has the molecular formula C24H19N5O2S4 and a molecular weight of 537.72 g/mol. Its IUPAC name is N-(5-cyano-3-phenyl-2-sulfanylidene-1,3-thiazol-4-yl)-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide.
| Compound Name | N-(5-cyano-3-phenyl-2-sulfanylidene-1,3-thiazol-4-yl)-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 53265042 |
| Molecular Formula | C24H19N5O2S4 |
| Molecular Weight | 537.72 g/mol |
| Exact Mass | 537.04 |
| IUPAC Name | N-(5-cyano-3-phenyl-2-sulfanylidene-1,3-thiazol-4-yl)-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2c(C#N)sc(=S)n2-c2ccccc2)nc2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C24H19N5O2S4/c1-2-11-28-22(31)19-15-9-6-10-16(15)34-21(19)27-23(28)33-13-18(30)26-20-17(12-25)35-24(32)29(20)14-7-4-3-5-8-14/h2-5,7-8H,1,6,9-11,13H2,(H,26,30) |
| InChIKey | GHKCECLNBMMQHV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.72 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|