C35H33N3O6S2 — CID 3916809
diethyl 5-[2,5-dimethyl-3-[2-(4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate (PubChem CID 3916809) has the molecular formula C35H33N3O6S2 and a molecular weight of 655.80 g/mol. Its IUPAC name is diethyl 5-[2,5-dimethyl-3-[2-(4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[2,5-dimethyl-3-[2-(4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3916809 |
| Molecular Formula | C35H33N3O6S2 |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.18 |
| IUPAC Name | diethyl 5-[2,5-dimethyl-3-[2-(4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate |
| SMILES | C=CCn1c(SCC(=O)c2cc(C)n(-c3cc(C(=O)OCC)cc(C(=O)OCC)c3)c2C)nc2sc(-c3ccccc3)cc2c1=O |
| InChI | InChI=1S/C35H33N3O6S2/c1-6-14-37-32(40)28-19-30(23-12-10-9-11-13-23)46-31(28)36-35(37)45-20-29(39)27-15-21(4)38(22(27)5)26-17-24(33(41)43-7-2)16-25(18-26)34(42)44-8-3/h6,9-13,15-19H,1,7-8,14,20H2,2-5H3 |
| InChIKey | UHNUKKPUACZTRO-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 109.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.80 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|