C23H25N3O3S2 — CID 55484043
N-(2-methyl-4-oxopentan-3-yl)-2-(4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 55484043) has the molecular formula C23H25N3O3S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is N-(2-methyl-4-oxopentan-3-yl)-2-(4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(2-methyl-4-oxopentan-3-yl)-2-(4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 55484043 |
| Molecular Formula | C23H25N3O3S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-(2-methyl-4-oxopentan-3-yl)-2-(4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)NC(C(C)=O)C(C)C)nc2sc(-c3ccccc3)cc2c1=O |
| InChI | InChI=1S/C23H25N3O3S2/c1-5-11-26-22(29)17-12-18(16-9-7-6-8-10-16)31-21(17)25-23(26)30-13-19(28)24-20(14(2)3)15(4)27/h5-10,12,14,20H,1,11,13H2,2-4H3,(H,24,28) |
| InChIKey | AKNFKTYXLSVJGI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|