C23H25N3O2S — CID 9407348
N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide (PubChem CID 9407348) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 9407348 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-[(1S)-1-(3,4-dimethylphenyl)ethyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)N[C@@H](C)c2ccc(C)c(C)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H25N3O2S/c1-5-12-26-22(28)19-8-6-7-9-20(19)25-23(26)29-14-21(27)24-17(4)18-11-10-15(2)16(3)13-18/h5-11,13,17H,1,12,14H2,2-4H3,(H,24,27)/t17-/m0/s1 |
| InChIKey | YZDHBFJXQOEKQU-KRWDZBQOSA-N |
| XLogP | 4.17 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|