C23H17F2N3O2S2 — CID 55320152
N-(2,5-difluorophenyl)-2-(4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 55320152) has the molecular formula C23H17F2N3O2S2 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-(4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(2,5-difluorophenyl)-2-(4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 55320152 |
| Molecular Formula | C23H17F2N3O2S2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-(4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(F)ccc2F)nc2sc(-c3ccccc3)cc2c1=O |
| InChI | InChI=1S/C23H17F2N3O2S2/c1-2-10-28-22(30)16-12-19(14-6-4-3-5-7-14)32-21(16)27-23(28)31-13-20(29)26-18-11-15(24)8-9-17(18)25/h2-9,11-12H,1,10,13H2,(H,26,29) |
| InChIKey | FGDKLWUMSPRVOJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|