C39H43N3O4S3 — CID 22693817
ethyl 2-[2,5-dimethyl-3-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate;toluene (PubChem CID 22693817) has the molecular formula C39H43N3O4S3 and a molecular weight of 713.99 g/mol. Its IUPAC name is ethyl 2-[2,5-dimethyl-3-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate;toluene.
| Compound Name | ethyl 2-[2,5-dimethyl-3-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate;toluene |
|---|---|
| PubChem CID | 22693817 |
| Molecular Formula | C39H43N3O4S3 |
| Molecular Weight | 713.99 g/mol |
| Exact Mass | 713.24 |
| IUPAC Name | ethyl 2-[2,5-dimethyl-3-[2-[(4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate;toluene |
| SMILES | C=CCn1c(SCC(=O)c2cc(C)n(-c3sc4c(c3C(=O)OCC)CCCC4)c2C)nc2sc3c(c2c1=O)CCCC3.Cc1ccccc1 |
| InChI | InChI=1S/C32H35N3O4S3.C7H8/c1-5-15-34-29(37)26-20-11-7-9-13-24(20)41-28(26)33-32(34)40-17-23(36)22-16-18(3)35(19(22)4)30-27(31(38)39-6-2)21-12-8-10-14-25(21)42-30;1-7-5-3-2-4-6-7/h5,16H,1,6-15,17H2,2-4H3;2-6H,1H3 |
| InChIKey | AXEGYIGCWRLSAG-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.99 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|