About N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide
N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide (PubChem CID 2442939) has the molecular formula C20H25Cl2N3O3
and a molecular weight of 426.34 g/mol. Its IUPAC name is N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide |
| PubChem CID | 2442939 |
| Molecular Formula | C20H25Cl2N3O3 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide |
| SMILES | CCN(CC(=O)NC(C)(C)C)C(=O)COc1c(Cl)cc(Cl)c2ccc(C)nc12 |
| InChI | InChI=1S/C20H25Cl2N3O3/c1-6-25(10-16(26)24-20(3,4)5)17(27)11-28-19-15(22)9-14(21)13-8-7-12(2)23-18(13)19/h7-9H,6,10-11H2,1-5H3,(H,24,26) |
| InChIKey | HKJFGEXDSONTPW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide?
The IUPAC name of N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide (CID 2442939) is N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide.
What is the SMILES notation for N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide?
The canonical SMILES for N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide is CCN(CC(=O)NC(C)(C)C)C(=O)COc1c(Cl)cc(Cl)c2ccc(C)nc12.
What is the InChIKey of N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide?
The InChIKey is HKJFGEXDSONTPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25Cl2N3O3/c1-6-25(10-16(26)24-20(3,4)5)17(27)11-28-19-15(22)9-14(21)13-8-7-12(2)23-18(13)19/h7-9H,6,10-11H2,1-5H3,(H,24,26).
What are the key properties of N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide?
N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide has a molecular weight of 426.34 g/mol, XLogP of 3.99, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-[[2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetyl]-ethylamino]acetamide is sourced from PubChem (CID 2442939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).