C17H23F3N2O3 — CID 55770776
N-tert-butyl-2-[ethyl-[2-[4-(trifluoromethyl)phenoxy]acetyl]amino]acetamide (PubChem CID 55770776) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is N-tert-butyl-2-[ethyl-[2-[4-(trifluoromethyl)phenoxy]acetyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[ethyl-[2-[4-(trifluoromethyl)phenoxy]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 55770776 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | N-tert-butyl-2-[ethyl-[2-[4-(trifluoromethyl)phenoxy]acetyl]amino]acetamide |
| SMILES | CCN(CC(=O)NC(C)(C)C)C(=O)COc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H23F3N2O3/c1-5-22(10-14(23)21-16(2,3)4)15(24)11-25-13-8-6-12(7-9-13)17(18,19)20/h6-9H,5,10-11H2,1-4H3,(H,21,23) |
| InChIKey | VIXSFLSIKKKPLM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |