C14H13N3OS — CID 2443590
N-[(2-methoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 2443590) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(2-methoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 2443590 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccccc1CNc1ncnc2sccc12 |
| InChI | InChI=1S/C14H13N3OS/c1-18-12-5-3-2-4-10(12)8-15-13-11-6-7-19-14(11)17-9-16-13/h2-7,9H,8H2,1H3,(H,15,16,17) |
| InChIKey | YMJVVLMLPQDQJH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |