C11H11Cl2N5O — CID 2447075
N-[2-(2,4-dichlorophenyl)ethyl]-2-(tetrazol-1-yl)acetamide (PubChem CID 2447075) has the molecular formula C11H11Cl2N5O and a molecular weight of 300.15 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 2447075 |
| Molecular Formula | C11H11Cl2N5O |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(tetrazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnnn1)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2N5O/c12-9-2-1-8(10(13)5-9)3-4-14-11(19)6-18-7-15-16-17-18/h1-2,5,7H,3-4,6H2,(H,14,19) |
| InChIKey | MBPMOJKNQLARML-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |