C16H21Cl2N5O — CID 99812550
1-[(2S)-1-(2,4-dichlorophenyl)propan-2-yl]-3-[4-(1,2,4-triazol-4-yl)butyl]urea (PubChem CID 99812550) has the molecular formula C16H21Cl2N5O and a molecular weight of 370.28 g/mol. Its IUPAC name is 1-[(2S)-1-(2,4-dichlorophenyl)propan-2-yl]-3-[4-(1,2,4-triazol-4-yl)butyl]urea.
| Compound Name | 1-[(2S)-1-(2,4-dichlorophenyl)propan-2-yl]-3-[4-(1,2,4-triazol-4-yl)butyl]urea |
|---|---|
| PubChem CID | 99812550 |
| Molecular Formula | C16H21Cl2N5O |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-[(2S)-1-(2,4-dichlorophenyl)propan-2-yl]-3-[4-(1,2,4-triazol-4-yl)butyl]urea |
| SMILES | C[C@@H](Cc1ccc(Cl)cc1Cl)NC(=O)NCCCCn1cnnc1 |
| InChI | InChI=1S/C16H21Cl2N5O/c1-12(8-13-4-5-14(17)9-15(13)18)22-16(24)19-6-2-3-7-23-10-20-21-11-23/h4-5,9-12H,2-3,6-8H2,1H3,(H2,19,22,24)/t12-/m0/s1 |
| InChIKey | SZFAAVRETRYPGS-LBPRGKRZSA-N |
| XLogP | 3.30 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|