C16H24ClN3O3S — CID 2447253
4-chloro-N-[[1-(dimethylamino)cyclohexyl]methyl]-3-sulfamoylbenzamide (PubChem CID 2447253) has the molecular formula C16H24ClN3O3S and a molecular weight of 373.90 g/mol. Its IUPAC name is 4-chloro-N-[[1-(dimethylamino)cyclohexyl]methyl]-3-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-[[1-(dimethylamino)cyclohexyl]methyl]-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 2447253 |
| Molecular Formula | C16H24ClN3O3S |
| Molecular Weight | 373.90 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-chloro-N-[[1-(dimethylamino)cyclohexyl]methyl]-3-sulfamoylbenzamide |
| SMILES | CN(C)C1(CCCCC1)CNC(=O)C2=CC(=C(C=C2)Cl)S(=O)(=O)N |
| InChI | InChI=1S/C16H24ClN3O3S/c1-20(2)16(8-4-3-5-9-16)11-19-15(21)12-6-7-13(17)14(10-12)24(18,22)23/h6-7,10H,3-5,8-9,11H2,1-2H3,(H,19,21)(H2,18,22,23) |
| InChIKey | KPZHOYVIVXYJQK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 101.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | 541 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.90 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |