About 2-phenylethyl 4-acetamidobenzoate
2-phenylethyl 4-acetamidobenzoate (PubChem CID 2449194) has the molecular formula C17H17NO3
and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-phenylethyl 4-acetamidobenzoate.
Molecular Properties
| Compound Name | 2-phenylethyl 4-acetamidobenzoate |
| PubChem CID | 2449194 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-phenylethyl 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H17NO3/c1-13(19)18-16-9-7-15(8-10-16)17(20)21-12-11-14-5-3-2-4-6-14/h2-10H,11-12H2,1H3,(H,18,19) |
| InChIKey | DLRJXOYSYPKXTE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylethyl 4-acetamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl 4-acetamidobenzoate?
The IUPAC name of 2-phenylethyl 4-acetamidobenzoate (CID 2449194) is 2-phenylethyl 4-acetamidobenzoate.
What is the SMILES notation for 2-phenylethyl 4-acetamidobenzoate?
The canonical SMILES for 2-phenylethyl 4-acetamidobenzoate is CC(=O)Nc1ccc(C(=O)OCCc2ccccc2)cc1.
What is the InChIKey of 2-phenylethyl 4-acetamidobenzoate?
The InChIKey is DLRJXOYSYPKXTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO3/c1-13(19)18-16-9-7-15(8-10-16)17(20)21-12-11-14-5-3-2-4-6-14/h2-10H,11-12H2,1H3,(H,18,19).
What are the key properties of 2-phenylethyl 4-acetamidobenzoate?
2-phenylethyl 4-acetamidobenzoate has a molecular weight of 283.33 g/mol, XLogP of 3.04, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl 4-acetamidobenzoate is sourced from PubChem (CID 2449194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).