C23H22BrNO6 — CID 24501688
ethyl (5Z)-2-anilino-5-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-4-oxofuran-3-carboxylate (PubChem CID 24501688) has the molecular formula C23H22BrNO6 and a molecular weight of 488.33 g/mol. Its IUPAC name is ethyl (5Z)-2-anilino-5-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-4-oxofuran-3-carboxylate.
| Compound Name | ethyl (5Z)-2-anilino-5-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-4-oxofuran-3-carboxylate |
|---|---|
| PubChem CID | 24501688 |
| Molecular Formula | C23H22BrNO6 |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | ethyl (5Z)-2-anilino-5-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-4-oxofuran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(Nc2ccccc2)O/C(=C\c2cc(Br)c(OC)c(OCC)c2)C1=O |
| InChI | InChI=1S/C23H22BrNO6/c1-4-29-18-13-14(11-16(24)21(18)28-3)12-17-20(26)19(23(27)30-5-2)22(31-17)25-15-9-7-6-8-10-15/h6-13,25H,4-5H2,1-3H3/b17-12- |
| InChIKey | OKJFYRDOHBPNSI-ATVHPVEESA-N |
| XLogP | 4.68 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|