C27H25N3O5 — CID 24501701
ethyl (5Z)-2-anilino-5-[(2-morpholin-4-ylquinolin-3-yl)methylidene]-4-oxofuran-3-carboxylate (PubChem CID 24501701) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is ethyl (5Z)-2-anilino-5-[(2-morpholin-4-ylquinolin-3-yl)methylidene]-4-oxofuran-3-carboxylate.
| Compound Name | ethyl (5Z)-2-anilino-5-[(2-morpholin-4-ylquinolin-3-yl)methylidene]-4-oxofuran-3-carboxylate |
|---|---|
| PubChem CID | 24501701 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | ethyl (5Z)-2-anilino-5-[(2-morpholin-4-ylquinolin-3-yl)methylidene]-4-oxofuran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(Nc2ccccc2)O/C(=C\c2cc3ccccc3nc2N2CCOCC2)C1=O |
| InChI | InChI=1S/C27H25N3O5/c1-2-34-27(32)23-24(31)22(35-26(23)28-20-9-4-3-5-10-20)17-19-16-18-8-6-7-11-21(18)29-25(19)30-12-14-33-15-13-30/h3-11,16-17,28H,2,12-15H2,1H3/b22-17- |
| InChIKey | XVFBSPZUXCZJDU-XLNRJJMWSA-N |
| XLogP | 3.90 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|