C21H19ClFN3O3S2 — CID 24501778
1-[4-chloro-3-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-(3-fluoro-4-methylphenyl)thiourea (PubChem CID 24501778) has the molecular formula C21H19ClFN3O3S2 and a molecular weight of 479.99 g/mol. Its IUPAC name is 1-[4-chloro-3-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-(3-fluoro-4-methylphenyl)thiourea.
| Compound Name | 1-[4-chloro-3-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-(3-fluoro-4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 24501778 |
| Molecular Formula | C21H19ClFN3O3S2 |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 1-[4-chloro-3-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-(3-fluoro-4-methylphenyl)thiourea |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(NC(=S)Nc2ccc(C)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C21H19ClFN3O3S2/c1-13-7-8-14(11-17(13)23)24-21(30)25-15-9-10-16(22)20(12-15)31(27,28)26-18-5-3-4-6-19(18)29-2/h3-12,26H,1-2H3,(H2,24,25,30) |
| InChIKey | KALYVMFKUIOPLP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|