C18H22FN5O4S2 — CID 24501782
1-[2-(diethylsulfamoyl)-4-nitroanilino]-3-(3-fluoro-4-methylphenyl)thiourea (PubChem CID 24501782) has the molecular formula C18H22FN5O4S2 and a molecular weight of 455.54 g/mol. Its IUPAC name is 1-[2-(diethylsulfamoyl)-4-nitroanilino]-3-(3-fluoro-4-methylphenyl)thiourea.
| Compound Name | 1-[2-(diethylsulfamoyl)-4-nitroanilino]-3-(3-fluoro-4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 24501782 |
| Molecular Formula | C18H22FN5O4S2 |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 1-[2-(diethylsulfamoyl)-4-nitroanilino]-3-(3-fluoro-4-methylphenyl)thiourea |
| SMILES | CCN(CC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1NNC(=S)Nc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C18H22FN5O4S2/c1-4-23(5-2)30(27,28)17-11-14(24(25)26)8-9-16(17)21-22-18(29)20-13-7-6-12(3)15(19)10-13/h6-11,21H,4-5H2,1-3H3,(H2,20,22,29) |
| InChIKey | OAMVOEITLWHXEG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|