C25H32N2O5 — CID 24505091
(E)-N-[1-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 24505091) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is (E)-N-[1-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 24505091 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (E)-N-[1-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C(=O)NC(CN1CCOCC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H32N2O5/c1-18-5-7-19(8-6-18)21(17-27-11-13-32-14-12-27)26-25(28)10-9-20-15-23(30-3)24(31-4)16-22(20)29-2/h5-10,15-16,21H,11-14,17H2,1-4H3,(H,26,28)/b10-9+ |
| InChIKey | XZDBTDXEQNMHQU-MDZDMXLPSA-N |
| XLogP | 3.22 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|