C23H28N2O2 — CID 9144809
(E)-3-(3-methylphenyl)-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]prop-2-enamide (PubChem CID 9144809) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (E)-3-(3-methylphenyl)-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-methylphenyl)-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9144809 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (E)-3-(3-methylphenyl)-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]prop-2-enamide |
| SMILES | Cc1ccc([C@H](CN2CCOCC2)NC(=O)/C=C/c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C23H28N2O2/c1-18-6-9-21(10-7-18)22(17-25-12-14-27-15-13-25)24-23(26)11-8-20-5-3-4-19(2)16-20/h3-11,16,22H,12-15,17H2,1-2H3,(H,24,26)/b11-8+/t22-/m0/s1 |
| InChIKey | KNYPDQCAZBNGJJ-NJTIBFSMSA-N |
| XLogP | 3.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|