C20H31BrN4O4 — CID 24507226
2-[4-[2-[2-(4-bromophenoxy)ethyl-methylamino]-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 24507226) has the molecular formula C20H31BrN4O4 and a molecular weight of 471.40 g/mol. Its IUPAC name is 2-[4-[2-[2-(4-bromophenoxy)ethyl-methylamino]-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-[2-[2-(4-bromophenoxy)ethyl-methylamino]-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 24507226 |
| Molecular Formula | C20H31BrN4O4 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2-[4-[2-[2-(4-bromophenoxy)ethyl-methylamino]-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1CCN(CC(=O)N(C)CCOc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H31BrN4O4/c1-23(12-14-29-18-5-3-17(21)4-6-18)20(27)16-25-10-8-24(9-11-25)15-19(26)22-7-13-28-2/h3-6H,7-16H2,1-2H3,(H,22,26) |
| InChIKey | GPEPFRKIVQWJPT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|