C18H28BrFIN5O2 — CID 111977490
2-[4-[N-[(4-bromo-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111977490) has the molecular formula C18H28BrFIN5O2 and a molecular weight of 572.26 g/mol. Its IUPAC name is 2-[4-[N-[(4-bromo-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[4-[N-[(4-bromo-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111977490 |
| Molecular Formula | C18H28BrFIN5O2 |
| Molecular Weight | 572.26 g/mol |
| Exact Mass | 571.05 |
| IUPAC Name | 2-[4-[N-[(4-bromo-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Br)cc1F)N1CCN(CC(=O)NCCOC)CC1.I |
| InChI | InChI=1S/C18H27BrFN5O2.HI/c1-21-18(23-12-14-3-4-15(19)11-16(14)20)25-8-6-24(7-9-25)13-17(26)22-5-10-27-2;/h3-4,11H,5-10,12-13H2,1-2H3,(H,21,23)(H,22,26);1H |
| InChIKey | RHQGGTAQAYLZCL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|