C16H22BrFN4O3 — CID 78894352
N-(2-bromo-4-fluorophenyl)-4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazine-1-carboxamide (PubChem CID 78894352) has the molecular formula C16H22BrFN4O3 and a molecular weight of 417.28 g/mol. Its IUPAC name is N-(2-bromo-4-fluorophenyl)-4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazine-1-carboxamide.
| Compound Name | N-(2-bromo-4-fluorophenyl)-4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 78894352 |
| Molecular Formula | C16H22BrFN4O3 |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | N-(2-bromo-4-fluorophenyl)-4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazine-1-carboxamide |
| SMILES | COCCNC(=O)CN1CCN(C(=O)Nc2ccc(F)cc2Br)CC1 |
| InChI | InChI=1S/C16H22BrFN4O3/c1-25-9-4-19-15(23)11-21-5-7-22(8-6-21)16(24)20-14-3-2-12(18)10-13(14)17/h2-3,10H,4-9,11H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | DFJHTTRDBOYOSC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|