C18H25F2N3O3 — CID 86929499
2-[4-[3-(3,4-difluorophenyl)propanoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 86929499) has the molecular formula C18H25F2N3O3 and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-[4-[3-(3,4-difluorophenyl)propanoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-[3-(3,4-difluorophenyl)propanoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 86929499 |
| Molecular Formula | C18H25F2N3O3 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-[4-[3-(3,4-difluorophenyl)propanoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1CCN(C(=O)CCc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H25F2N3O3/c1-26-11-6-21-17(24)13-22-7-9-23(10-8-22)18(25)5-3-14-2-4-15(19)16(20)12-14/h2,4,12H,3,5-11,13H2,1H3,(H,21,24) |
| InChIKey | LTWKNTWKBHIWHZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|