C20H28F2N4O4 — CID 55428497
2,4-difluoro-N-[3-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]-3-oxopropyl]benzamide (PubChem CID 55428497) has the molecular formula C20H28F2N4O4 and a molecular weight of 426.46 g/mol. Its IUPAC name is 2,4-difluoro-N-[3-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]-3-oxopropyl]benzamide.
| Compound Name | 2,4-difluoro-N-[3-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 55428497 |
| Molecular Formula | C20H28F2N4O4 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2,4-difluoro-N-[3-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]-3-oxopropyl]benzamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)CCNC(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C20H28F2N4O4/c1-30-12-2-6-23-18(27)14-25-8-10-26(11-9-25)19(28)5-7-24-20(29)16-4-3-15(21)13-17(16)22/h3-4,13H,2,5-12,14H2,1H3,(H,23,27)(H,24,29) |
| InChIKey | MBNFQSPUSXOVOP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|