C24H36N6O — CID 24507299
N-[4-(diethylamino)phenyl]-2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]acetamide (PubChem CID 24507299) has the molecular formula C24H36N6O and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]acetamide.
| Compound Name | N-[4-(diethylamino)phenyl]-2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 24507299 |
| Molecular Formula | C24H36N6O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CN2CCN(c3cc(C)nc(C(C)C)n3)CC2)cc1 |
| InChI | InChI=1S/C24H36N6O/c1-6-29(7-2)21-10-8-20(9-11-21)26-23(31)17-28-12-14-30(15-13-28)22-16-19(5)25-24(27-22)18(3)4/h8-11,16,18H,6-7,12-15,17H2,1-5H3,(H,26,31) |
| InChIKey | QRHRPFLATRNWDM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|