C20H23Cl4N5O — CID 26376603
2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide (PubChem CID 26376603) has the molecular formula C20H23Cl4N5O and a molecular weight of 491.25 g/mol. Its IUPAC name is 2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide.
| Compound Name | 2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide |
|---|---|
| PubChem CID | 26376603 |
| Molecular Formula | C20H23Cl4N5O |
| Molecular Weight | 491.25 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-N-(2,3,5,6-tetrachlorophenyl)acetamide |
| SMILES | Cc1cc(N2CCN(CC(=O)Nc3c(Cl)c(Cl)cc(Cl)c3Cl)CC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C20H23Cl4N5O/c1-11(2)20-25-12(3)8-15(26-20)29-6-4-28(5-7-29)10-16(30)27-19-17(23)13(21)9-14(22)18(19)24/h8-9,11H,4-7,10H2,1-3H3,(H,27,30) |
| InChIKey | VMNKFRDRIHVKAJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.25 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|