C20H15FN4O3 — CID 24509234
1-(4-fluorophenyl)-5-methyl-N-(4-methyl-2-oxochromen-7-yl)-1,2,4-triazole-3-carboxamide (PubChem CID 24509234) has the molecular formula C20H15FN4O3 and a molecular weight of 378.36 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-methyl-N-(4-methyl-2-oxochromen-7-yl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-5-methyl-N-(4-methyl-2-oxochromen-7-yl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 24509234 |
| Molecular Formula | C20H15FN4O3 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 1-(4-fluorophenyl)-5-methyl-N-(4-methyl-2-oxochromen-7-yl)-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)c3nc(C)n(-c4ccc(F)cc4)n3)ccc12 |
| InChI | InChI=1S/C20H15FN4O3/c1-11-9-18(26)28-17-10-14(5-8-16(11)17)23-20(27)19-22-12(2)25(24-19)15-6-3-13(21)4-7-15/h3-10H,1-2H3,(H,23,27) |
| InChIKey | LWFPHOVMJNXWRW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|