C21H15FN2O4S — CID 24672163
2-[(4-fluorophenoxy)methyl]-N-(4-methyl-2-oxochromen-7-yl)-1,3-thiazole-4-carboxamide (PubChem CID 24672163) has the molecular formula C21H15FN2O4S and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[(4-fluorophenoxy)methyl]-N-(4-methyl-2-oxochromen-7-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(4-fluorophenoxy)methyl]-N-(4-methyl-2-oxochromen-7-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 24672163 |
| Molecular Formula | C21H15FN2O4S |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2-[(4-fluorophenoxy)methyl]-N-(4-methyl-2-oxochromen-7-yl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)c3csc(COc4ccc(F)cc4)n3)ccc12 |
| InChI | InChI=1S/C21H15FN2O4S/c1-12-8-20(25)28-18-9-14(4-7-16(12)18)23-21(26)17-11-29-19(24-17)10-27-15-5-2-13(22)3-6-15/h2-9,11H,10H2,1H3,(H,23,26) |
| InChIKey | NRQZHSJKABMOPZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|