C22H21F3N6OS — CID 24509502
3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]propanamide (PubChem CID 24509502) has the molecular formula C22H21F3N6OS and a molecular weight of 474.51 g/mol. Its IUPAC name is 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 24509502 |
| Molecular Formula | C22H21F3N6OS |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1ccc(Cc2cnc(NC(=O)CCc3c(C)nc4nc(C(F)(F)F)nn4c3C)s2)cc1 |
| InChI | InChI=1S/C22H21F3N6OS/c1-12-4-6-15(7-5-12)10-16-11-26-21(33-16)28-18(32)9-8-17-13(2)27-20-29-19(22(23,24)25)30-31(20)14(17)3/h4-7,11H,8-10H2,1-3H3,(H,26,28,32) |
| InChIKey | PFJAQEOYKJUQTF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |