C20H16F4N6OS — CID 46632424
3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 46632424) has the molecular formula C20H16F4N6OS and a molecular weight of 464.45 g/mol. Its IUPAC name is 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 46632424 |
| Molecular Formula | C20H16F4N6OS |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1nc2nc(C(F)(F)F)nn2c(C)c1CCC(=O)Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C20H16F4N6OS/c1-10-14(11(2)30-18(25-10)28-17(29-30)20(22,23)24)7-8-16(31)27-19-26-15(9-32-19)12-3-5-13(21)6-4-12/h3-6,9H,7-8H2,1-2H3,(H,26,27,31) |
| InChIKey | OKAATTQXNJSBTJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |